C11H10F4O3 — CID 14401450
2-(1,1,2,2-tetrafluoro-2-phenoxyethyl)-1,3-dioxolane (PubChem CID 14401450) has the molecular formula C11H10F4O3 and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-(1,1,2,2-tetrafluoro-2-phenoxyethyl)-1,3-dioxolane.
| Compound Name | 2-(1,1,2,2-tetrafluoro-2-phenoxyethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 14401450 |
| Molecular Formula | C11H10F4O3 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-(1,1,2,2-tetrafluoro-2-phenoxyethyl)-1,3-dioxolane |
| SMILES | FC(F)(Oc1ccccc1)C(F)(F)C1OCCO1 |
| InChI | InChI=1S/C11H10F4O3/c12-10(13,9-16-6-7-17-9)11(14,15)18-8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | DYUWQXCAUCZISK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|