C7H10F4O4 — CID 14401455
2-methoxy-2-(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane (PubChem CID 14401455) has the molecular formula C7H10F4O4 and a molecular weight of 234.14 g/mol. Its IUPAC name is 2-methoxy-2-(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane.
| Compound Name | 2-methoxy-2-(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 14401455 |
| Molecular Formula | C7H10F4O4 |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-methoxy-2-(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane |
| SMILES | COC(F)(F)C(F)(F)C1(OC)OCCO1 |
| InChI | InChI=1S/C7H10F4O4/c1-12-6(10,11)5(8,9)7(13-2)14-3-4-15-7/h3-4H2,1-2H3 |
| InChIKey | IRBQUWZMMRSJTM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|