C9H10F8O4 — CID 14401463
2,2-bis(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane (PubChem CID 14401463) has the molecular formula C9H10F8O4 and a molecular weight of 334.16 g/mol. Its IUPAC name is 2,2-bis(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane.
| Compound Name | 2,2-bis(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 14401463 |
| Molecular Formula | C9H10F8O4 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2,2-bis(1,1,2,2-tetrafluoro-2-methoxyethyl)-1,3-dioxolane |
| SMILES | COC(F)(F)C(F)(F)C1(C(F)(F)C(F)(F)OC)OCCO1 |
| InChI | InChI=1S/C9H10F8O4/c1-18-8(14,15)5(10,11)7(20-3-4-21-7)6(12,13)9(16,17)19-2/h3-4H2,1-2H3 |
| InChIKey | CYTQPMMIYMPRRP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|