C17H8F6N2O2 — CID 14401887
[4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate (PubChem CID 14401887) has the molecular formula C17H8F6N2O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is [4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate.
| Compound Name | [4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate |
|---|---|
| PubChem CID | 14401887 |
| Molecular Formula | C17H8F6N2O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [4-[2-(4-cyanatophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] cyanate |
| SMILES | N#COc1ccc(C(c2ccc(OC#N)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H8F6N2O2/c18-16(19,20)15(17(21,22)23,11-1-5-13(6-2-11)26-9-24)12-3-7-14(8-4-12)27-10-25/h1-8H |
| InChIKey | INHGSGHLQLYYND-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|