C15H13F4N3O3S2 — CID 14403007
2-[[3-methoxy-4-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole (PubChem CID 14403007) has the molecular formula C15H13F4N3O3S2 and a molecular weight of 423.41 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-[[3-methoxy-4-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 14403007 |
| Molecular Formula | C15H13F4N3O3S2 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-[[3-methoxy-4-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole |
| SMILES | COc1c(OCC(F)(F)C(F)F)ccnc1CS(=O)c1nc2cscc2[nH]1 |
| InChI | InChI=1S/C15H13F4N3O3S2/c1-24-12-10(6-27(23)14-21-8-4-26-5-9(8)22-14)20-3-2-11(12)25-7-15(18,19)13(16)17/h2-5,13H,6-7H2,1H3,(H,21,22) |
| InChIKey | UJFSIWKHBMCHCN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|