About 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole
5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole (PubChem CID 14403472) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole.
Molecular Properties
| Compound Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole |
| PubChem CID | 14403472 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole |
| SMILES | CCCn1cncc1/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H24N2/c1-5-9-17-12-16-11-15(17)10-14(4)8-6-7-13(2)3/h7,10-12H,5-6,8-9H2,1-4H3/b14-10+ |
| InChIKey | VLTKZMAJGLJTKF-GXDHUFHOSA-N |
| XLogP | 4.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole?
The IUPAC name of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole (CID 14403472) is 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole.
What is the SMILES notation for 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole?
The canonical SMILES for 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole is CCCn1cncc1/C=C(\C)CCC=C(C)C.
What is the InChIKey of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole?
The InChIKey is VLTKZMAJGLJTKF-GXDHUFHOSA-N. The full InChI is InChI=1S/C15H24N2/c1-5-9-17-12-16-11-15(17)10-14(4)8-6-7-13(2)3/h7,10-12H,5-6,8-9H2,1-4H3/b14-10+.
What are the key properties of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole?
5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole has a molecular weight of 232.37 g/mol, XLogP of 4.44, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propylimidazole is sourced from PubChem (CID 14403472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).