About 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole
5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole (PubChem CID 14403474) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole.
Molecular Properties
| Compound Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole |
| PubChem CID | 14403474 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole |
| SMILES | CCCCCn1cncc1/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H28N2/c1-5-6-7-11-19-14-18-13-17(19)12-16(4)10-8-9-15(2)3/h9,12-14H,5-8,10-11H2,1-4H3/b16-12+ |
| InChIKey | AGTHHOQYAQDNSL-FOWTUZBSSA-N |
| XLogP | 5.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole?
The IUPAC name of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole (CID 14403474) is 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole.
What is the SMILES notation for 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole?
The canonical SMILES for 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole is CCCCCn1cncc1/C=C(\C)CCC=C(C)C.
What is the InChIKey of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole?
The InChIKey is AGTHHOQYAQDNSL-FOWTUZBSSA-N. The full InChI is InChI=1S/C17H28N2/c1-5-6-7-11-19-14-18-13-17(19)12-16(4)10-8-9-15(2)3/h9,12-14H,5-8,10-11H2,1-4H3/b16-12+.
What are the key properties of 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole?
5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole has a molecular weight of 260.43 g/mol, XLogP of 5.22, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-pentylimidazole is sourced from PubChem (CID 14403474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).