C12H16N4O2 — CID 14403687
11-tert-butyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione (PubChem CID 14403687) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 11-tert-butyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione.
| Compound Name | 11-tert-butyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
|---|---|
| PubChem CID | 14403687 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 11-tert-butyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
| SMILES | CC(C)(C)N1C(=O)C2Cc3nc[nH]c3CN2C1=O |
| InChI | InChI=1S/C12H16N4O2/c1-12(2,3)16-10(17)9-4-7-8(14-6-13-7)5-15(9)11(16)18/h6,9H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | ORFGYURFJRKJEX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|