C15H14N4O4S — CID 14403696
11-(4-methylsulfonylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione (PubChem CID 14403696) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is 11-(4-methylsulfonylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione.
| Compound Name | 11-(4-methylsulfonylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
|---|---|
| PubChem CID | 14403696 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 11-(4-methylsulfonylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
| SMILES | CS(=O)(=O)c1ccc(N2C(=O)C3Cc4nc[nH]c4CN3C2=O)cc1 |
| InChI | InChI=1S/C15H14N4O4S/c1-24(22,23)10-4-2-9(3-5-10)19-14(20)13-6-11-12(17-8-16-11)7-18(13)15(19)21/h2-5,8,13H,6-7H2,1H3,(H,16,17) |
| InChIKey | PQMRNIBMYPJWTF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|