C11H14N4OS — CID 14403726
11-propyl-12-sulfanylidene-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-10-one (PubChem CID 14403726) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 11-propyl-12-sulfanylidene-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-10-one.
| Compound Name | 11-propyl-12-sulfanylidene-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-10-one |
|---|---|
| PubChem CID | 14403726 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 11-propyl-12-sulfanylidene-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-10-one |
| SMILES | CCCN1C(=O)C2Cc3nc[nH]c3CN2C1=S |
| InChI | InChI=1S/C11H14N4OS/c1-2-3-14-10(16)9-4-7-8(13-6-12-7)5-15(9)11(14)17/h6,9H,2-5H2,1H3,(H,12,13) |
| InChIKey | KFTSERTZVAUFDH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|