C24H24N4O2 — CID 14403745
4-benzyl-11-(4-propan-2-ylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione (PubChem CID 14403745) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-benzyl-11-(4-propan-2-ylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione.
| Compound Name | 4-benzyl-11-(4-propan-2-ylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
|---|---|
| PubChem CID | 14403745 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-benzyl-11-(4-propan-2-ylphenyl)-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
| SMILES | CC(C)c1ccc(N2C(=O)C3Cc4ncn(Cc5ccccc5)c4CN3C2=O)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-16(2)18-8-10-19(11-9-18)28-23(29)21-12-20-22(14-27(21)24(28)30)26(15-25-20)13-17-6-4-3-5-7-17/h3-11,15-16,21H,12-14H2,1-2H3 |
| InChIKey | BSUPAZUFJSSEHZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|