C17H19ClOS — CID 14404513
4-[(4-chlorophenyl)methoxy]-1-methyl-2-propylsulfanylbenzene (PubChem CID 14404513) has the molecular formula C17H19ClOS and a molecular weight of 306.86 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-1-methyl-2-propylsulfanylbenzene.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-1-methyl-2-propylsulfanylbenzene |
|---|---|
| PubChem CID | 14404513 |
| Molecular Formula | C17H19ClOS |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-1-methyl-2-propylsulfanylbenzene |
| SMILES | CCCSc1cc(OCc2ccc(Cl)cc2)ccc1C |
| InChI | InChI=1S/C17H19ClOS/c1-3-10-20-17-11-16(9-4-13(17)2)19-12-14-5-7-15(18)8-6-14/h4-9,11H,3,10,12H2,1-2H3 |
| InChIKey | NVFAXWCPOPDRLR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |