About 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide
4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide (PubChem CID 14405282) has the molecular formula C9H18N6O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide |
| PubChem CID | 14405282 |
| Molecular Formula | C9H18N6O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide |
| SMILES | Cc1nn(C(=O)NC(C)CN(C)C)c(=O)n1N |
| InChI | InChI=1S/C9H18N6O2/c1-6(5-13(3)4)11-8(16)15-9(17)14(10)7(2)12-15/h6H,5,10H2,1-4H3,(H,11,16) |
| InChIKey | SKESAFBCWLXFHB-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide?
The IUPAC name of 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide (CID 14405282) is 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide?
The canonical SMILES for 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide is Cc1nn(C(=O)NC(C)CN(C)C)c(=O)n1N.
What is the InChIKey of 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide?
The InChIKey is SKESAFBCWLXFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N6O2/c1-6(5-13(3)4)11-8(16)15-9(17)14(10)7(2)12-15/h6H,5,10H2,1-4H3,(H,11,16).
What are the key properties of 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide?
4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide has a molecular weight of 242.28 g/mol, XLogP of -1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[1-(dimethylamino)propan-2-yl]-3-methyl-5-oxo-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 14405282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).