About tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate
tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 14405818) has the molecular formula C15H28N2O3S
and a molecular weight of 316.47 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate |
| PubChem CID | 14405818 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC1CSCC(C)C1NC(=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O3S/c1-9-7-21-8-10(2)12(9)17-13(18)11(3)16-14(19)20-15(4,5)6/h9-12H,7-8H2,1-6H3,(H,16,19)(H,17,18)/t9?,10?,11-,12?/m1/s1 |
| InChIKey | BATIPNKQVMAMNS-QDLLBCNESA-N |
| XLogP | 2.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate (CID 14405818) is tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate is CC1CSCC(C)C1NC(=O)[C@@H](C)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate?
The InChIKey is BATIPNKQVMAMNS-QDLLBCNESA-N. The full InChI is InChI=1S/C15H28N2O3S/c1-9-7-21-8-10(2)12(9)17-13(18)11(3)16-14(19)20-15(4,5)6/h9-12H,7-8H2,1-6H3,(H,16,19)(H,17,18)/t9?,10?,11-,12?/m1/s1.
What are the key properties of tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate?
tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate has a molecular weight of 316.47 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2R)-1-[(3,5-dimethylthian-4-yl)amino]-1-oxopropan-2-yl]carbamate is sourced from PubChem (CID 14405818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).