C18H20ClN9O3 — CID 14406038
methyl 4-[[[(cyanoamino)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethylamino]methylidene]amino]methyl]benzoate (PubChem CID 14406038) has the molecular formula C18H20ClN9O3 and a molecular weight of 445.87 g/mol. Its IUPAC name is methyl 4-[[[(cyanoamino)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethylamino]methylidene]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(cyanoamino)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethylamino]methylidene]amino]methyl]benzoate |
|---|---|
| PubChem CID | 14406038 |
| Molecular Formula | C18H20ClN9O3 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | methyl 4-[[[(cyanoamino)-[2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethylamino]methylidene]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C/N=C(\NC#N)NCCNC(=O)c2nc(Cl)c(N)nc2N)cc1 |
| InChI | InChI=1S/C18H20ClN9O3/c1-31-17(30)11-4-2-10(3-5-11)8-25-18(26-9-20)24-7-6-23-16(29)12-14(21)28-15(22)13(19)27-12/h2-5H,6-8H2,1H3,(H,23,29)(H4,21,22,28)(H2,24,25,26) |
| InChIKey | VZJIVNKPMAILRT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 193.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|