About 5,5-difluoropentan-1-amine
5,5-difluoropentan-1-amine (PubChem CID 14407044) has the molecular formula C5H11F2N
and a molecular weight of 123.15 g/mol. Its IUPAC name is 5,5-difluoropentan-1-amine.
Molecular Properties
| Compound Name | 5,5-difluoropentan-1-amine |
| PubChem CID | 14407044 |
| Molecular Formula | C5H11F2N |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | 5,5-difluoropentan-1-amine |
| SMILES | NCCCCC(F)F |
| InChI | InChI=1S/C5H11F2N/c6-5(7)3-1-2-4-8/h5H,1-4,8H2 |
| InChIKey | PZURDJRXXCQKLZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluoropentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoropentan-1-amine?
The IUPAC name of 5,5-difluoropentan-1-amine (CID 14407044) is 5,5-difluoropentan-1-amine.
What is the SMILES notation for 5,5-difluoropentan-1-amine?
The canonical SMILES for 5,5-difluoropentan-1-amine is NCCCCC(F)F.
What is the InChIKey of 5,5-difluoropentan-1-amine?
The InChIKey is PZURDJRXXCQKLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F2N/c6-5(7)3-1-2-4-8/h5H,1-4,8H2.
What are the key properties of 5,5-difluoropentan-1-amine?
5,5-difluoropentan-1-amine has a molecular weight of 123.15 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoropentan-1-amine is sourced from PubChem (CID 14407044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).