About N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide
N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide (PubChem CID 14407230) has the molecular formula C12H25N3O4
and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide |
| PubChem CID | 14407230 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide |
| SMILES | CC(C)(CNC(=O)N1CCOCC1)NCC(O)CO |
| InChI | InChI=1S/C12H25N3O4/c1-12(2,14-7-10(17)8-16)9-13-11(18)15-3-5-19-6-4-15/h10,14,16-17H,3-9H2,1-2H3,(H,13,18) |
| InChIKey | BZHHZSJZKYZTJT-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide?
The IUPAC name of N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide (CID 14407230) is N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide.
What is the SMILES notation for N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide?
The canonical SMILES for N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide is CC(C)(CNC(=O)N1CCOCC1)NCC(O)CO.
What is the InChIKey of N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide?
The InChIKey is BZHHZSJZKYZTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O4/c1-12(2,14-7-10(17)8-16)9-13-11(18)15-3-5-19-6-4-15/h10,14,16-17H,3-9H2,1-2H3,(H,13,18).
What are the key properties of N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide?
N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide has a molecular weight of 275.35 g/mol, XLogP of -1.25, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydroxypropylamino)-2-methylpropyl]morpholine-4-carboxamide is sourced from PubChem (CID 14407230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).