About 2-[(2,2-dimethyloxan-4-yl)amino]ethanol
2-[(2,2-dimethyloxan-4-yl)amino]ethanol (PubChem CID 14407589) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(2,2-dimethyloxan-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,2-dimethyloxan-4-yl)amino]ethanol |
| PubChem CID | 14407589 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2-[(2,2-dimethyloxan-4-yl)amino]ethanol |
| SMILES | CC1(C)CC(NCCO)CCO1 |
| InChI | InChI=1S/C9H19NO2/c1-9(2)7-8(3-6-12-9)10-4-5-11/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | MJTNLTVIJFKLBM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,2-dimethyloxan-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
The IUPAC name of 2-[(2,2-dimethyloxan-4-yl)amino]ethanol (CID 14407589) is 2-[(2,2-dimethyloxan-4-yl)amino]ethanol.
What is the SMILES notation for 2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
The canonical SMILES for 2-[(2,2-dimethyloxan-4-yl)amino]ethanol is CC1(C)CC(NCCO)CCO1.
What is the InChIKey of 2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
The InChIKey is MJTNLTVIJFKLBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-9(2)7-8(3-6-12-9)10-4-5-11/h8,10-11H,3-7H2,1-2H3.
What are the key properties of 2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
2-[(2,2-dimethyloxan-4-yl)amino]ethanol has a molecular weight of 173.26 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethyloxan-4-yl)amino]ethanol is sourced from PubChem (CID 14407589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).