C18H28O3SSi — CID 14408016
(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3,6-dihydro-2H-pyran-3-ol (PubChem CID 14408016) has the molecular formula C18H28O3SSi and a molecular weight of 352.57 g/mol. Its IUPAC name is (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 14408016 |
| Molecular Formula | C18H28O3SSi |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](Sc2ccccc2)C=C[C@H]1O |
| InChI | InChI=1S/C18H28O3SSi/c1-18(2,3)23(4,5)20-13-16-15(19)11-12-17(21-16)22-14-9-7-6-8-10-14/h6-12,15-17,19H,13H2,1-5H3/t15-,16-,17-/m1/s1 |
| InChIKey | NLYVBPGSBMWAMX-BRWVUGGUSA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|