About tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane
tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane (PubChem CID 14409370) has the molecular formula C20H40OS2Si
and a molecular weight of 388.76 g/mol. Its IUPAC name is tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane |
| PubChem CID | 14409370 |
| Molecular Formula | C20H40OS2Si |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC/C=C\CC(CCC1SCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40OS2Si/c1-7-8-9-10-11-12-13-18(14-15-19-22-16-17-23-19)21-24(5,6)20(2,3)4/h11-12,18-19H,7-10,13-17H2,1-6H3/b12-11- |
| InChIKey | JGPZGXRERMTSNZ-QXMHVHEDSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane (CID 14409370) is tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane is CCCCC/C=C\CC(CCC1SCCS1)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane?
The InChIKey is JGPZGXRERMTSNZ-QXMHVHEDSA-N. The full InChI is InChI=1S/C20H40OS2Si/c1-7-8-9-10-11-12-13-18(14-15-19-22-16-17-23-19)21-24(5,6)20(2,3)4/h11-12,18-19H,7-10,13-17H2,1-6H3/b12-11-.
What are the key properties of tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane?
tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane has a molecular weight of 388.76 g/mol, XLogP of 7.49, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z)-1-(1,3-dithiolan-2-yl)undec-5-en-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 14409370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).