C27H27NO5 — CID 14409405
(NZ)-N-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]hydroxylamine (PubChem CID 14409405) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is (NZ)-N-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 14409405 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (NZ)-N-[(3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]hydroxylamine |
| SMILES | CC1(C)O[C@@H]2[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O/C(=N\O)[C@@H]2O1 |
| InChI | InChI=1S/C27H27NO5/c1-26(2)32-23-22(31-25(28-29)24(23)33-26)18-30-27(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-24,29H,18H2,1-2H3/b28-25-/t22-,23-,24-/m1/s1 |
| InChIKey | CZYPEFWSXLXTQG-DGAMAAQWSA-N |
| XLogP | 4.70 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|