C40H58O2 — CID 14409606
(8E,10E,12E,14E,16E,18E,20E,22E,24E)-2-hydroxy-6,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-8,10,12,14,16,18,20,22,24-nonaen-7-one (PubChem CID 14409606) has the molecular formula C40H58O2 and a molecular weight of 570.90 g/mol. Its IUPAC name is (8E,10E,12E,14E,16E,18E,20E,22E,24E)-2-hydroxy-6,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-8,10,12,14,16,18,20,22,24-nonaen-7-one.
| Compound Name | (8E,10E,12E,14E,16E,18E,20E,22E,24E)-2-hydroxy-6,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-8,10,12,14,16,18,20,22,24-nonaen-7-one |
|---|---|
| PubChem CID | 14409606 |
| Molecular Formula | C40H58O2 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.44 |
| IUPAC Name | (8E,10E,12E,14E,16E,18E,20E,22E,24E)-2-hydroxy-6,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-8,10,12,14,16,18,20,22,24-nonaen-7-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C(=O)C(C)(C)CCCC(C)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H58O2/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38(42)40(9,10)30-16-24-36(6)41/h11-14,17-22,25-28,36,41H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | TUNCSYYNDGSMRA-JLTXGRSLSA-N |
| XLogP | 11.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|