C10H13NO3 — CID 14409956
methyl 3-(5-formyl-2-methyl-1H-pyrrol-3-yl)propanoate (PubChem CID 14409956) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl 3-(5-formyl-2-methyl-1H-pyrrol-3-yl)propanoate.
| Compound Name | methyl 3-(5-formyl-2-methyl-1H-pyrrol-3-yl)propanoate |
|---|---|
| PubChem CID | 14409956 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | methyl 3-(5-formyl-2-methyl-1H-pyrrol-3-yl)propanoate |
| SMILES | COC(=O)CCc1cc(C=O)[nH]c1C |
| InChI | InChI=1S/C10H13NO3/c1-7-8(3-4-10(13)14-2)5-9(6-12)11-7/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | UPUZPLUBGJXVCU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|