About 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione
5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione (PubChem CID 14412241) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione |
| PubChem CID | 14412241 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione |
| SMILES | CC1CC(=O)c2c(O)cccc2C1=O |
| InChI | InChI=1S/C11H10O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-4,6,12H,5H2,1H3 |
| InChIKey | ALPCEXCHMFUSAN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione?
The IUPAC name of 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione (CID 14412241) is 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione.
What is the SMILES notation for 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione?
The canonical SMILES for 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione is CC1CC(=O)c2c(O)cccc2C1=O.
What is the InChIKey of 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione?
The InChIKey is ALPCEXCHMFUSAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-4,6,12H,5H2,1H3.
What are the key properties of 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione?
5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione has a molecular weight of 190.20 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione is sourced from PubChem (CID 14412241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).