C16H24O4 — CID 14412622
(4S,5R)-4-[(1E)-buta-1,3-dienyl]-5-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 14412622) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (4S,5R)-4-[(1E)-buta-1,3-dienyl]-5-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(1E)-buta-1,3-dienyl]-5-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 14412622 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (4S,5R)-4-[(1E)-buta-1,3-dienyl]-5-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C/C=C/[C@@H]1OC(C)(C)O[C@H]1[C@@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C16H24O4/c1-7-9-10-12-14(20-16(5,6)18-12)13-11(8-2)17-15(3,4)19-13/h7-14H,1-2H2,3-6H3/b10-9+/t11-,12+,13-,14-/m1/s1 |
| InChIKey | TTWVJRWPGHXWAJ-HEUUUEPYSA-N |
| XLogP | 2.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|