C27H25N3O2 — CID 1441278
N-(2-phenylethyl)-6-(4-phenylmethoxyanilino)pyridine-3-carboxamide (PubChem CID 1441278) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-(2-phenylethyl)-6-(4-phenylmethoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(2-phenylethyl)-6-(4-phenylmethoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1441278 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-(2-phenylethyl)-6-(4-phenylmethoxyanilino)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(Nc2ccc(OCc3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C27H25N3O2/c31-27(28-18-17-21-7-3-1-4-8-21)23-11-16-26(29-19-23)30-24-12-14-25(15-13-24)32-20-22-9-5-2-6-10-22/h1-16,19H,17-18,20H2,(H,28,31)(H,29,30) |
| InChIKey | GTOOBADXBDFWEG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |