About 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol
1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol (PubChem CID 14412982) has the molecular formula C10H17F3O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol |
| PubChem CID | 14412982 |
| Molecular Formula | C10H17F3O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol |
| SMILES | CC1(O)CCC(C(C)(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3O2/c1-8(14)5-3-7(4-6-8)9(2,15)10(11,12)13/h7,14-15H,3-6H2,1-2H3 |
| InChIKey | QQEOCSNPKYMWBS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol?
The IUPAC name of 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol (CID 14412982) is 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol.
What is the SMILES notation for 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol?
The canonical SMILES for 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol is CC1(O)CCC(C(C)(O)C(F)(F)F)CC1.
What is the InChIKey of 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol?
The InChIKey is QQEOCSNPKYMWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O2/c1-8(14)5-3-7(4-6-8)9(2,15)10(11,12)13/h7,14-15H,3-6H2,1-2H3.
What are the key properties of 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol?
1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol has a molecular weight of 226.24 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 14412982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).