About (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one
(1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 14413531) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 14413531 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C=C[C@@]12CC[C@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C11H16O/c1-4-11-6-5-8(7-9(11)12)10(11,2)3/h4,8H,1,5-7H2,2-3H3/t8-,11-/m1/s1 |
| InChIKey | UEVFTEJYOXJPNL-LDYMZIIASA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one (CID 14413531) is (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one is C=C[C@@]12CC[C@H](CC1=O)C2(C)C.
What is the InChIKey of (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is UEVFTEJYOXJPNL-LDYMZIIASA-N. The full InChI is InChI=1S/C11H16O/c1-4-11-6-5-8(7-9(11)12)10(11,2)3/h4,8H,1,5-7H2,2-3H3/t8-,11-/m1/s1.
What are the key properties of (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
(1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 164.25 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 14413531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).