About N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide
N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide (PubChem CID 1441369) has the molecular formula C24H25N3O4
and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide |
| PubChem CID | 1441369 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2ccccn2)c(OCC)cc1NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-4-30-21-15-20(27-24(29)18-8-6-7-13-25-18)22(31-5-2)14-19(21)26-23(28)17-11-9-16(3)10-12-17/h6-15H,4-5H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | AZEGFXFEIRGTQY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide?
The IUPAC name of N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide (CID 1441369) is N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide.
What is the SMILES notation for N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide?
The canonical SMILES for N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide is CCOc1cc(NC(=O)c2ccccn2)c(OCC)cc1NC(=O)c1ccc(C)cc1.
What is the InChIKey of N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide?
The InChIKey is AZEGFXFEIRGTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O4/c1-4-30-21-15-20(27-24(29)18-8-6-7-13-25-18)22(31-5-2)14-19(21)26-23(28)17-11-9-16(3)10-12-17/h6-15H,4-5H2,1-3H3,(H,26,28)(H,27,29).
What are the key properties of N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide?
N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide has a molecular weight of 419.48 g/mol, XLogP of 4.69, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-diethoxy-4-[(4-methylbenzoyl)amino]phenyl]pyridine-2-carboxamide is sourced from PubChem (CID 1441369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).