About benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate
benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate (PubChem CID 14413859) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate |
| PubChem CID | 14413859 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate |
| SMILES | C[C@H](c1ccccc1)N1C(=O)[C@@H](NC(=O)OCc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C20H22N2O4/c1-14(16-10-6-3-7-11-16)22-17(12-23)18(19(22)24)21-20(25)26-13-15-8-4-2-5-9-15/h2-11,14,17-18,23H,12-13H2,1H3,(H,21,25)/t14-,17-,18+/m1/s1 |
| InChIKey | FVLMHOGVFBAYQB-OLMNPRSZSA-N |
| XLogP | 2.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate?
The IUPAC name of benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate (CID 14413859) is benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate.
What is the SMILES notation for benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate?
The canonical SMILES for benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate is C[C@H](c1ccccc1)N1C(=O)[C@@H](NC(=O)OCc2ccccc2)[C@H]1CO.
What is the InChIKey of benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate?
The InChIKey is FVLMHOGVFBAYQB-OLMNPRSZSA-N. The full InChI is InChI=1S/C20H22N2O4/c1-14(16-10-6-3-7-11-16)22-17(12-23)18(19(22)24)21-20(25)26-13-15-8-4-2-5-9-15/h2-11,14,17-18,23H,12-13H2,1H3,(H,21,25)/t14-,17-,18+/m1/s1.
What are the key properties of benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate?
benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate has a molecular weight of 354.41 g/mol, XLogP of 2.25, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2S,3S)-2-(hydroxymethyl)-4-oxo-1-[(1R)-1-phenylethyl]azetidin-3-yl]carbamate is sourced from PubChem (CID 14413859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).