C22H32O6 — CID 14414238
[(1S,2R,4aR,8aR)-1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2,3-dimethyloxirane-2-carboxylate (PubChem CID 14414238) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [(1S,2R,4aR,8aR)-1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(1S,2R,4aR,8aR)-1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 14414238 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(1S,2R,4aR,8aR)-1-acetyloxy-1,4a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2,3-dimethyloxirane-2-carboxylate |
| SMILES | CC(=O)O[C@@]1(C)[C@@H]2CC(=C(C)C)C(=O)C[C@@]2(C)CC[C@H]1OC(=O)C1(C)OC1C |
| InChI | InChI=1S/C22H32O6/c1-12(2)15-10-17-20(5,11-16(15)24)9-8-18(22(17,7)28-14(4)23)26-19(25)21(6)13(3)27-21/h13,17-18H,8-11H2,1-7H3/t13?,17-,18-,20-,21?,22+/m1/s1 |
| InChIKey | APZBLWQCTHVAMR-XRZTVBGOSA-N |
| XLogP | 3.51 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|