About 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride
3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride (PubChem CID 14415060) has the molecular formula C12H18ClNO2
and a molecular weight of 243.73 g/mol. Its IUPAC name is 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride |
| PubChem CID | 14415060 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride |
| SMILES | CC1N(C)CCOC1(O)c1ccccc1.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-10-12(14,15-9-8-13(10)2)11-6-4-3-5-7-11;/h3-7,10,14H,8-9H2,1-2H3;1H |
| InChIKey | JXBDWUBNRBGJGA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride?
The IUPAC name of 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride (CID 14415060) is 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride.
What is the SMILES notation for 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride?
The canonical SMILES for 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride is CC1N(C)CCOC1(O)c1ccccc1.Cl.
What is the InChIKey of 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride?
The InChIKey is JXBDWUBNRBGJGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.ClH/c1-10-12(14,15-9-8-13(10)2)11-6-4-3-5-7-11;/h3-7,10,14H,8-9H2,1-2H3;1H.
What are the key properties of 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride?
3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride has a molecular weight of 243.73 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2-phenylmorpholin-2-ol;hydrochloride is sourced from PubChem (CID 14415060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).