C14H19NO4 — CID 14415092
3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methylbutanoic acid (PubChem CID 14415092) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methylbutanoic acid.
| Compound Name | 3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 14415092 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methylbutanoic acid |
| SMILES | CNC1=C(C)C(=O)C(C)=C(C(C)(C)CC(=O)O)C1=O |
| InChI | InChI=1S/C14H19NO4/c1-7-10(14(3,4)6-9(16)17)13(19)11(15-5)8(2)12(7)18/h15H,6H2,1-5H3,(H,16,17) |
| InChIKey | VJWXPHVZMRAEKJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|