C18H25Cl2NO5 — CID 14415095
N,N-bis(2-chloroethyl)-3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanamide (PubChem CID 14415095) has the molecular formula C18H25Cl2NO5 and a molecular weight of 406.31 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanamide.
| Compound Name | N,N-bis(2-chloroethyl)-3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 14415095 |
| Molecular Formula | C18H25Cl2NO5 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N,N-bis(2-chloroethyl)-3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanamide |
| SMILES | COC1=C(OC)C(=O)C(C(C)(C)CC(=O)N(CCCl)CCCl)=C(C)C1=O |
| InChI | InChI=1S/C18H25Cl2NO5/c1-11-13(15(24)17(26-5)16(25-4)14(11)23)18(2,3)10-12(22)21(8-6-19)9-7-20/h6-10H2,1-5H3 |
| InChIKey | AETQCNYRTFTNEV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|