C16H24N2O3 — CID 14415097
3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-N,N,3-trimethylbutanamide (PubChem CID 14415097) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-N,N,3-trimethylbutanamide.
| Compound Name | 3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-N,N,3-trimethylbutanamide |
|---|---|
| PubChem CID | 14415097 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[2,4-dimethyl-5-(methylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]-N,N,3-trimethylbutanamide |
| SMILES | CNC1=C(C)C(=O)C(C)=C(C(C)(C)CC(=O)N(C)C)C1=O |
| InChI | InChI=1S/C16H24N2O3/c1-9-12(16(3,4)8-11(19)18(6)7)15(21)13(17-5)10(2)14(9)20/h17H,8H2,1-7H3 |
| InChIKey | QUIYSFIKWXXHPA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|