C25H30F3N3O10 — CID 14415359
2,4-dinitro-N-[2-(1,4,7,10,13-pentaoxacyclohexadec-15-ylmethoxy)phenyl]-6-(trifluoromethyl)aniline (PubChem CID 14415359) has the molecular formula C25H30F3N3O10 and a molecular weight of 589.52 g/mol. Its IUPAC name is 2,4-dinitro-N-[2-(1,4,7,10,13-pentaoxacyclohexadec-15-ylmethoxy)phenyl]-6-(trifluoromethyl)aniline.
| Compound Name | 2,4-dinitro-N-[2-(1,4,7,10,13-pentaoxacyclohexadec-15-ylmethoxy)phenyl]-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 14415359 |
| Molecular Formula | C25H30F3N3O10 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 2,4-dinitro-N-[2-(1,4,7,10,13-pentaoxacyclohexadec-15-ylmethoxy)phenyl]-6-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccccc2OCC2COCCOCCOCCOCCOC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H30F3N3O10/c26-25(27,28)20-13-19(30(32)33)14-22(31(34)35)24(20)29-21-3-1-2-4-23(21)41-17-18-15-39-11-9-37-7-5-36-6-8-38-10-12-40-16-18/h1-4,13-14,18,29H,5-12,15-17H2 |
| InChIKey | AUHIUTHVUOQICU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|