C12H12ClN — CID 14415821
8-chloro-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 14415821) has the molecular formula C12H12ClN and a molecular weight of 205.69 g/mol. Its IUPAC name is 8-chloro-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 8-chloro-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 14415821 |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 8-chloro-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Clc1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C12H12ClN/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h3,5-6,14H,1-2,4,7H2 |
| InChIKey | XHUILMSPQYMDEP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|