C7H7F9OS — CID 14416232
3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethanol (PubChem CID 14416232) has the molecular formula C7H7F9OS and a molecular weight of 310.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethanol.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethanol |
|---|---|
| PubChem CID | 14416232 |
| Molecular Formula | C7H7F9OS |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethanol |
| SMILES | OCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F9OS/c8-4(9,1-2-18-3-17)5(10,11)6(12,13)7(14,15)16/h17H,1-3H2 |
| InChIKey | DWHGCNBKRBXXAN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|