C9H7F13OS — CID 14416233
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethanol (PubChem CID 14416233) has the molecular formula C9H7F13OS and a molecular weight of 410.20 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethanol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethanol |
|---|---|
| PubChem CID | 14416233 |
| Molecular Formula | C9H7F13OS |
| Molecular Weight | 410.20 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethanol |
| SMILES | OCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F13OS/c10-4(11,1-2-24-3-23)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h23H,1-3H2 |
| InChIKey | WONXEWFEWOTKDL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|