About 3-Methylenehexyl acetate
3-Methylenehexyl acetate (PubChem CID 14416698) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-methylidenehexyl acetate.
Molecular Properties
| Compound Name | 3-Methylenehexyl acetate |
| PubChem CID | 14416698 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-methylidenehexyl acetate |
| SMILES | CCCC(=C)CCOC(=O)C |
| InChI | InChI=1S/C9H16O2/c1-4-5-8(2)6-7-11-9(3)10/h2,4-7H2,1,3H3 |
| InChIKey | LANNBUOMKVZPEI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | 138 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-Methylenehexyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Methylenehexyl acetate?
The IUPAC name of 3-Methylenehexyl acetate (CID 14416698) is 3-methylidenehexyl acetate.
What is the SMILES notation for 3-Methylenehexyl acetate?
The canonical SMILES for 3-Methylenehexyl acetate is CCCC(=C)CCOC(=O)C.
What is the InChIKey of 3-Methylenehexyl acetate?
The InChIKey is LANNBUOMKVZPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-5-8(2)6-7-11-9(3)10/h2,4-7H2,1,3H3.
What are the key properties of 3-Methylenehexyl acetate?
3-Methylenehexyl acetate has a molecular weight of 156.22 g/mol, XLogP of 2.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Methylenehexyl acetate is sourced from PubChem (CID 14416698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).