C11H8S8 — CID 14416877
2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methyl-[1,3]dithiolo[4,5-b][1,4]dithiine (PubChem CID 14416877) has the molecular formula C11H8S8 and a molecular weight of 396.72 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methyl-[1,3]dithiolo[4,5-b][1,4]dithiine.
| Compound Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methyl-[1,3]dithiolo[4,5-b][1,4]dithiine |
|---|---|
| PubChem CID | 14416877 |
| Molecular Formula | C11H8S8 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 395.84 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-methyl-[1,3]dithiolo[4,5-b][1,4]dithiine |
| SMILES | CC1=CSC2=C(S1)SC(=C1SC3=C(SCCS3)S1)S2 |
| InChI | InChI=1S/C11H8S8/c1-5-4-14-8-9(15-5)19-11(18-8)10-16-6-7(17-10)13-3-2-12-6/h4H,2-3H2,1H3 |
| InChIKey | GLVQCXPNHKNKOW-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |