About (4S)-1,4-dimethylpyrrolidin-2-one
(4S)-1,4-dimethylpyrrolidin-2-one (PubChem CID 14417042) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is (4S)-1,4-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (4S)-1,4-dimethylpyrrolidin-2-one |
| PubChem CID | 14417042 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (4S)-1,4-dimethylpyrrolidin-2-one |
| SMILES | C[C@H]1CC(=O)N(C)C1 |
| InChI | InChI=1S/C6H11NO/c1-5-3-6(8)7(2)4-5/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | AXSSJSFXWMOTEN-YFKPBYRVSA-N |
| XLogP | 0.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-1,4-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,4-dimethylpyrrolidin-2-one?
The IUPAC name of (4S)-1,4-dimethylpyrrolidin-2-one (CID 14417042) is (4S)-1,4-dimethylpyrrolidin-2-one.
What is the SMILES notation for (4S)-1,4-dimethylpyrrolidin-2-one?
The canonical SMILES for (4S)-1,4-dimethylpyrrolidin-2-one is C[C@H]1CC(=O)N(C)C1.
What is the InChIKey of (4S)-1,4-dimethylpyrrolidin-2-one?
The InChIKey is AXSSJSFXWMOTEN-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11NO/c1-5-3-6(8)7(2)4-5/h5H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of (4S)-1,4-dimethylpyrrolidin-2-one?
(4S)-1,4-dimethylpyrrolidin-2-one has a molecular weight of 113.16 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,4-dimethylpyrrolidin-2-one is sourced from PubChem (CID 14417042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).