About 4H-thieno[3,2-c]chromen-2-ylmethanol
4H-thieno[3,2-c]chromen-2-ylmethanol (PubChem CID 14417815) has the molecular formula C12H10O2S
and a molecular weight of 218.28 g/mol. Its IUPAC name is 4H-thieno[3,2-c]chromen-2-ylmethanol.
Molecular Properties
| Compound Name | 4H-thieno[3,2-c]chromen-2-ylmethanol |
| PubChem CID | 14417815 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4H-thieno[3,2-c]chromen-2-ylmethanol |
| SMILES | OCc1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C12H10O2S/c13-6-9-5-8-7-14-11-4-2-1-3-10(11)12(8)15-9/h1-5,13H,6-7H2 |
| InChIKey | GNMQRKKQKXYMPR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-thieno[3,2-c]chromen-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-thieno[3,2-c]chromen-2-ylmethanol?
The IUPAC name of 4H-thieno[3,2-c]chromen-2-ylmethanol (CID 14417815) is 4H-thieno[3,2-c]chromen-2-ylmethanol.
What is the SMILES notation for 4H-thieno[3,2-c]chromen-2-ylmethanol?
The canonical SMILES for 4H-thieno[3,2-c]chromen-2-ylmethanol is OCc1cc2c(s1)-c1ccccc1OC2.
What is the InChIKey of 4H-thieno[3,2-c]chromen-2-ylmethanol?
The InChIKey is GNMQRKKQKXYMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S/c13-6-9-5-8-7-14-11-4-2-1-3-10(11)12(8)15-9/h1-5,13H,6-7H2.
What are the key properties of 4H-thieno[3,2-c]chromen-2-ylmethanol?
4H-thieno[3,2-c]chromen-2-ylmethanol has a molecular weight of 218.28 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-thieno[3,2-c]chromen-2-ylmethanol is sourced from PubChem (CID 14417815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).