About ethanolate;tetrabutylazanium
ethanolate;tetrabutylazanium (PubChem CID 14417848) has the molecular formula C18H41NO
and a molecular weight of 287.53 g/mol. Its IUPAC name is ethanolate;tetrabutylazanium.
Molecular Properties
| Compound Name | ethanolate;tetrabutylazanium |
| PubChem CID | 14417848 |
| Molecular Formula | C18H41NO |
| Molecular Weight | 287.53 g/mol |
| Exact Mass | 287.32 |
| IUPAC Name | ethanolate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CC[O-] |
| InChI | InChI=1S/C16H36N.C2H5O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3/h5-16H2,1-4H3;2H2,1H3/q+1;-1 |
| InChIKey | SNUBRLWUQHFANK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;tetrabutylazanium?
The IUPAC name of ethanolate;tetrabutylazanium (CID 14417848) is ethanolate;tetrabutylazanium.
What is the SMILES notation for ethanolate;tetrabutylazanium?
The canonical SMILES for ethanolate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.CC[O-].
What is the InChIKey of ethanolate;tetrabutylazanium?
The InChIKey is SNUBRLWUQHFANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C2H5O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3/h5-16H2,1-4H3;2H2,1H3/q+1;-1.
What are the key properties of ethanolate;tetrabutylazanium?
ethanolate;tetrabutylazanium has a molecular weight of 287.53 g/mol, XLogP of 4.37, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;tetrabutylazanium is sourced from PubChem (CID 14417848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).