About N,N'-di(butan-2-yl)ethane-1,2-diimine
N,N'-di(butan-2-yl)ethane-1,2-diimine (PubChem CID 14418028) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N,N'-di(butan-2-yl)ethane-1,2-diimine.
Molecular Properties
| Compound Name | N,N'-di(butan-2-yl)ethane-1,2-diimine |
| PubChem CID | 14418028 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N,N'-di(butan-2-yl)ethane-1,2-diimine |
| SMILES | CCC(C)/N=C/C=N/C(C)CC |
| InChI | InChI=1S/C10H20N2/c1-5-9(3)11-7-8-12-10(4)6-2/h7-10H,5-6H2,1-4H3/b11-7+,12-8+ |
| InChIKey | LGEVDHRHEISTDG-MKICQXMISA-N |
| XLogP | 2.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-di(butan-2-yl)ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-di(butan-2-yl)ethane-1,2-diimine?
The IUPAC name of N,N'-di(butan-2-yl)ethane-1,2-diimine (CID 14418028) is N,N'-di(butan-2-yl)ethane-1,2-diimine.
What is the SMILES notation for N,N'-di(butan-2-yl)ethane-1,2-diimine?
The canonical SMILES for N,N'-di(butan-2-yl)ethane-1,2-diimine is CCC(C)/N=C/C=N/C(C)CC.
What is the InChIKey of N,N'-di(butan-2-yl)ethane-1,2-diimine?
The InChIKey is LGEVDHRHEISTDG-MKICQXMISA-N. The full InChI is InChI=1S/C10H20N2/c1-5-9(3)11-7-8-12-10(4)6-2/h7-10H,5-6H2,1-4H3/b11-7+,12-8+.
What are the key properties of N,N'-di(butan-2-yl)ethane-1,2-diimine?
N,N'-di(butan-2-yl)ethane-1,2-diimine has a molecular weight of 168.28 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-di(butan-2-yl)ethane-1,2-diimine is sourced from PubChem (CID 14418028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).