C12H21NO2 — CID 14418367
(2E)-N-methoxy-N,3,7-trimethylocta-2,6-dienamide (PubChem CID 14418367) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (2E)-N-methoxy-N,3,7-trimethylocta-2,6-dienamide.
| Compound Name | (2E)-N-methoxy-N,3,7-trimethylocta-2,6-dienamide |
|---|---|
| PubChem CID | 14418367 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2E)-N-methoxy-N,3,7-trimethylocta-2,6-dienamide |
| SMILES | CON(C)C(=O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H21NO2/c1-10(2)7-6-8-11(3)9-12(14)13(4)15-5/h7,9H,6,8H2,1-5H3/b11-9+ |
| InChIKey | KLWKQJGISOJCFA-PKNBQFBNSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|