About 2,2-difluoro-3,4-dihydrochromene
2,2-difluoro-3,4-dihydrochromene (PubChem CID 14418574) has the molecular formula C9H8F2O
and a molecular weight of 170.16 g/mol. Its IUPAC name is 2,2-difluoro-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 2,2-difluoro-3,4-dihydrochromene |
| PubChem CID | 14418574 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2,2-difluoro-3,4-dihydrochromene |
| SMILES | FC1(F)CCc2ccccc2O1 |
| InChI | InChI=1S/C9H8F2O/c10-9(11)6-5-7-3-1-2-4-8(7)12-9/h1-4H,5-6H2 |
| InChIKey | ICCGDOXSRPJAQR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3,4-dihydrochromene?
The IUPAC name of 2,2-difluoro-3,4-dihydrochromene (CID 14418574) is 2,2-difluoro-3,4-dihydrochromene.
What is the SMILES notation for 2,2-difluoro-3,4-dihydrochromene?
The canonical SMILES for 2,2-difluoro-3,4-dihydrochromene is FC1(F)CCc2ccccc2O1.
What is the InChIKey of 2,2-difluoro-3,4-dihydrochromene?
The InChIKey is ICCGDOXSRPJAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O/c10-9(11)6-5-7-3-1-2-4-8(7)12-9/h1-4H,5-6H2.
What are the key properties of 2,2-difluoro-3,4-dihydrochromene?
2,2-difluoro-3,4-dihydrochromene has a molecular weight of 170.16 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3,4-dihydrochromene is sourced from PubChem (CID 14418574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).