C18H36N2O — CID 14419058
N-octyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 14419058) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is N-octyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-octyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 14419058 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | N-octyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CCCCCCCCN(C=O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C18H36N2O/c1-6-7-8-9-10-11-12-20(15-21)16-13-17(2,3)19-18(4,5)14-16/h15-16,19H,6-14H2,1-5H3 |
| InChIKey | RLKVDNCNPGSFDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|