C22H42N4O2 — CID 14419063
N-[2-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 14419063) has the molecular formula C22H42N4O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is N-[2-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-[2-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 14419063 |
| Molecular Formula | C22H42N4O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | N-[2-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CC1(C)CC(N(C=O)CCN(C=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H42N4O2/c1-19(2)11-17(12-20(3,4)23-19)25(15-27)9-10-26(16-28)18-13-21(5,6)24-22(7,8)14-18/h15-18,23-24H,9-14H2,1-8H3 |
| InChIKey | UQTZIMIVDFDCMU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|