About [(2R)-oxiran-2-yl]methyl benzenesulfonate
[(2R)-oxiran-2-yl]methyl benzenesulfonate (PubChem CID 14419639) has the molecular formula C9H10O4S
and a molecular weight of 214.24 g/mol. Its IUPAC name is [(2R)-oxiran-2-yl]methyl benzenesulfonate.
Molecular Properties
| Compound Name | [(2R)-oxiran-2-yl]methyl benzenesulfonate |
| PubChem CID | 14419639 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | [(2R)-oxiran-2-yl]methyl benzenesulfonate |
| SMILES | O=S(=O)(OC[C@H]1CO1)c1ccccc1 |
| InChI | InChI=1S/C9H10O4S/c10-14(11,13-7-8-6-12-8)9-4-2-1-3-5-9/h1-5,8H,6-7H2/t8-/m1/s1 |
| InChIKey | PGIGXJYEXSOUNZ-MRVPVSSYSA-N |
| XLogP | 0.79 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxiran-2-yl]methyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxiran-2-yl]methyl benzenesulfonate?
The IUPAC name of [(2R)-oxiran-2-yl]methyl benzenesulfonate (CID 14419639) is [(2R)-oxiran-2-yl]methyl benzenesulfonate.
What is the SMILES notation for [(2R)-oxiran-2-yl]methyl benzenesulfonate?
The canonical SMILES for [(2R)-oxiran-2-yl]methyl benzenesulfonate is O=S(=O)(OC[C@H]1CO1)c1ccccc1.
What is the InChIKey of [(2R)-oxiran-2-yl]methyl benzenesulfonate?
The InChIKey is PGIGXJYEXSOUNZ-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H10O4S/c10-14(11,13-7-8-6-12-8)9-4-2-1-3-5-9/h1-5,8H,6-7H2/t8-/m1/s1.
What are the key properties of [(2R)-oxiran-2-yl]methyl benzenesulfonate?
[(2R)-oxiran-2-yl]methyl benzenesulfonate has a molecular weight of 214.24 g/mol, XLogP of 0.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxiran-2-yl]methyl benzenesulfonate is sourced from PubChem (CID 14419639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).